C23H26N2O5 — CID 155884612
benzyl 5-[(2-acetamido-3-phenylpropanoyl)amino]-4-oxopentanoate (PubChem CID 155884612) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is benzyl 5-[(2-acetamido-3-phenylpropanoyl)amino]-4-oxopentanoate.
| Compound Name | benzyl 5-[(2-acetamido-3-phenylpropanoyl)amino]-4-oxopentanoate |
|---|---|
| PubChem CID | 155884612 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | benzyl 5-[(2-acetamido-3-phenylpropanoyl)amino]-4-oxopentanoate |
| SMILES | CC(=O)NC(Cc1ccccc1)C(=O)NCC(=O)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H26N2O5/c1-17(26)25-21(14-18-8-4-2-5-9-18)23(29)24-15-20(27)12-13-22(28)30-16-19-10-6-3-7-11-19/h2-11,21H,12-16H2,1H3,(H,24,29)(H,25,26) |
| InChIKey | LXTOTMLHIMIEEI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |