C28H38N2O7Si — CID 10530540
5-O-benzyl 1-O-(2-trimethylsilylethyl) (2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioate (PubChem CID 10530540) has the molecular formula C28H38N2O7Si and a molecular weight of 542.71 g/mol. Its IUPAC name is 5-O-benzyl 1-O-(2-trimethylsilylethyl) (2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioate.
| Compound Name | 5-O-benzyl 1-O-(2-trimethylsilylethyl) (2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 10530540 |
| Molecular Formula | C28H38N2O7Si |
| Molecular Weight | 542.71 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 5-O-benzyl 1-O-(2-trimethylsilylethyl) (2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioate |
| SMILES | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCC(=O)OCc1ccccc1)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C28H38N2O7Si/c1-20(31)29-25(18-21-10-12-23(32)13-11-21)27(34)30-24(28(35)36-16-17-38(2,3)4)14-15-26(33)37-19-22-8-6-5-7-9-22/h5-13,24-25,32H,14-19H2,1-4H3,(H,29,31)(H,30,34)/t24-,25-/m0/s1 |
| InChIKey | HXOJBKAOQVQIQT-DQEYMECFSA-N |
| XLogP | 3.33 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.71 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|