C28H30N2O6 — CID 10505220
benzyl N-[(2S)-1-oxo-1-[[2-oxo-3-(phenylmethoxymethoxy)propyl]amino]-3-phenylpropan-2-yl]carbamate (PubChem CID 10505220) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-1-[[2-oxo-3-(phenylmethoxymethoxy)propyl]amino]-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-1-[[2-oxo-3-(phenylmethoxymethoxy)propyl]amino]-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10505220 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-1-[[2-oxo-3-(phenylmethoxymethoxy)propyl]amino]-3-phenylpropan-2-yl]carbamate |
| SMILES | O=C(CNC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)COCOCc1ccccc1 |
| InChI | InChI=1S/C28H30N2O6/c31-25(20-35-21-34-18-23-12-6-2-7-13-23)17-29-27(32)26(16-22-10-4-1-5-11-22)30-28(33)36-19-24-14-8-3-9-15-24/h1-15,26H,16-21H2,(H,29,32)(H,30,33)/t26-/m0/s1 |
| InChIKey | MZOHUBBKIMGVAQ-SANMLTNESA-N |
| XLogP | 3.40 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|