C20H23N5O4S — CID 18276525
benzyl N-[(2S)-5-amino-1,5-dioxo-1-[2-(phenylcarbamothioyl)hydrazinyl]pentan-2-yl]carbamate (PubChem CID 18276525) has the molecular formula C20H23N5O4S and a molecular weight of 429.50 g/mol. Its IUPAC name is benzyl N-[(2S)-5-amino-1,5-dioxo-1-[2-(phenylcarbamothioyl)hydrazinyl]pentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-amino-1,5-dioxo-1-[2-(phenylcarbamothioyl)hydrazinyl]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18276525 |
| Molecular Formula | C20H23N5O4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | benzyl N-[(2S)-5-amino-1,5-dioxo-1-[2-(phenylcarbamothioyl)hydrazinyl]pentan-2-yl]carbamate |
| SMILES | NC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C20H23N5O4S/c21-17(26)12-11-16(23-20(28)29-13-14-7-3-1-4-8-14)18(27)24-25-19(30)22-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H2,21,26)(H,23,28)(H,24,27)(H2,22,25,30)/t16-/m0/s1 |
| InChIKey | IHQPMLUQXBPQKC-INIZCTEOSA-N |
| XLogP | 1.56 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|