C9H13F2NO4S — CID 167733808
(2S)-4-(difluoromethylsulfanyl)-2-(prop-2-enoxycarbonylamino)butanoic acid (PubChem CID 167733808) has the molecular formula C9H13F2NO4S and a molecular weight of 269.27 g/mol. Its IUPAC name is (2S)-4-(difluoromethylsulfanyl)-2-(prop-2-enoxycarbonylamino)butanoic acid.
| Compound Name | (2S)-4-(difluoromethylsulfanyl)-2-(prop-2-enoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 167733808 |
| Molecular Formula | C9H13F2NO4S |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (2S)-4-(difluoromethylsulfanyl)-2-(prop-2-enoxycarbonylamino)butanoic acid |
| SMILES | C=CCOC(=O)N[C@@H](CCSC(F)F)C(=O)O |
| InChI | InChI=1S/C9H13F2NO4S/c1-2-4-16-9(15)12-6(7(13)14)3-5-17-8(10)11/h2,6,8H,1,3-5H2,(H,12,15)(H,13,14)/t6-/m0/s1 |
| InChIKey | UOOYEGRGPKUELV-LURJTMIESA-N |
| XLogP | 1.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|