C18H41N3O2Si2 — CID 91804971
[(2R,3R,4S)-5-azido-2-[tert-butyl(dimethyl)silyl]oxy-4-methylpentan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 91804971) has the molecular formula C18H41N3O2Si2 and a molecular weight of 387.72 g/mol. Its IUPAC name is [(2R,3R,4S)-5-azido-2-[tert-butyl(dimethyl)silyl]oxy-4-methylpentan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4S)-5-azido-2-[tert-butyl(dimethyl)silyl]oxy-4-methylpentan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 91804971 |
| Molecular Formula | C18H41N3O2Si2 |
| Molecular Weight | 387.72 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | [(2R,3R,4S)-5-azido-2-[tert-butyl(dimethyl)silyl]oxy-4-methylpentan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H](CN=[N+]=[N-])[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H41N3O2Si2/c1-14(13-20-21-19)16(23-25(11,12)18(6,7)8)15(2)22-24(9,10)17(3,4)5/h14-16H,13H2,1-12H3/t14-,15+,16+/m0/s1 |
| InChIKey | LNAPKZPINDWJPU-ARFHVFGLSA-N |
| XLogP | 6.73 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.72 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|