C12H25N3O3Si — CID 100999058
(5S)-5-[(1S)-2-azido-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-ol (PubChem CID 100999058) has the molecular formula C12H25N3O3Si and a molecular weight of 287.44 g/mol. Its IUPAC name is (5S)-5-[(1S)-2-azido-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-ol.
| Compound Name | (5S)-5-[(1S)-2-azido-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-ol |
|---|---|
| PubChem CID | 100999058 |
| Molecular Formula | C12H25N3O3Si |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (5S)-5-[(1S)-2-azido-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CN=[N+]=[N-])[C@@H]1CCC(O)O1 |
| InChI | InChI=1S/C12H25N3O3Si/c1-12(2,3)19(4,5)18-10(8-14-15-13)9-6-7-11(16)17-9/h9-11,16H,6-8H2,1-5H3/t9-,10-,11?/m0/s1 |
| InChIKey | QUXODTHKDVVHBU-QRHSGQBVSA-N |
| XLogP | 3.18 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|