C22H42N4O4Si — CID 86726822
tert-butyl (4R)-4-[(1R,2S)-3-azido-1-[tert-butyl(dimethyl)silyl]oxy-2-cyclopropylpropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 86726822) has the molecular formula C22H42N4O4Si and a molecular weight of 454.69 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(1R,2S)-3-azido-1-[tert-butyl(dimethyl)silyl]oxy-2-cyclopropylpropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(1R,2S)-3-azido-1-[tert-butyl(dimethyl)silyl]oxy-2-cyclopropylpropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 86726822 |
| Molecular Formula | C22H42N4O4Si |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | tert-butyl (4R)-4-[(1R,2S)-3-azido-1-[tert-butyl(dimethyl)silyl]oxy-2-cyclopropylpropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](CN=[N+]=[N-])C2CC2)COC1(C)C |
| InChI | InChI=1S/C22H42N4O4Si/c1-20(2,3)29-19(27)26-17(14-28-22(26,7)8)18(30-31(9,10)21(4,5)6)16(13-24-25-23)15-11-12-15/h15-18H,11-14H2,1-10H3/t16-,17-,18-/m1/s1 |
| InChIKey | AOGGTPNAILZSBJ-KZNAEPCWSA-N |
| XLogP | 6.09 |
| TPSA | 96.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|