C18H35NO5Si — CID 88980904
tert-butyl (4S)-2,2-dimethyl-4-[(1S)-2-oxo-1-triethylsilyloxyethyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 88980904) has the molecular formula C18H35NO5Si and a molecular weight of 373.57 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-[(1S)-2-oxo-1-triethylsilyloxyethyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-[(1S)-2-oxo-1-triethylsilyloxyethyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 88980904 |
| Molecular Formula | C18H35NO5Si |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-[(1S)-2-oxo-1-triethylsilyloxyethyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H](C=O)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H35NO5Si/c1-9-25(10-2,11-3)24-15(12-20)14-13-22-18(7,8)19(14)16(21)23-17(4,5)6/h12,14-15H,9-11,13H2,1-8H3/t14-,15+/m0/s1 |
| InChIKey | SLBXEYCQZFXUIL-LSDHHAIUSA-N |
| XLogP | 3.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|