C21H41NO4Si — CID 88980900
tert-butyl 2,2-dimethyl-4-[(1R)-1-triethylsilyloxypent-4-enyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 88980900) has the molecular formula C21H41NO4Si and a molecular weight of 399.65 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-4-[(1R)-1-triethylsilyloxypent-4-enyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 2,2-dimethyl-4-[(1R)-1-triethylsilyloxypent-4-enyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 88980900 |
| Molecular Formula | C21H41NO4Si |
| Molecular Weight | 399.65 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | tert-butyl 2,2-dimethyl-4-[(1R)-1-triethylsilyloxypent-4-enyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCC[C@@H](O[Si](CC)(CC)CC)C1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H41NO4Si/c1-10-14-15-18(26-27(11-2,12-3)13-4)17-16-24-21(8,9)22(17)19(23)25-20(5,6)7/h10,17-18H,1,11-16H2,2-9H3/t17?,18-/m1/s1 |
| InChIKey | YROKJYUCJDQGSK-QRWMCTBCSA-N |
| XLogP | 5.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|