C9H21N3O2Si — CID 71369485
(2S)-3-azido-2-[tert-butyl(dimethyl)silyl]oxypropan-1-ol (PubChem CID 71369485) has the molecular formula C9H21N3O2Si and a molecular weight of 231.37 g/mol. Its IUPAC name is (2S)-3-azido-2-[tert-butyl(dimethyl)silyl]oxypropan-1-ol.
| Compound Name | (2S)-3-azido-2-[tert-butyl(dimethyl)silyl]oxypropan-1-ol |
|---|---|
| PubChem CID | 71369485 |
| Molecular Formula | C9H21N3O2Si |
| Molecular Weight | 231.37 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | (2S)-3-azido-2-[tert-butyl(dimethyl)silyl]oxypropan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CO)CN=[N+]=[N-] |
| InChI | InChI=1S/C9H21N3O2Si/c1-9(2,3)15(4,5)14-8(7-13)6-11-12-10/h8,13H,6-7H2,1-5H3/t8-/m0/s1 |
| InChIKey | ORXFTSMRFKTEFA-QMMMGPOBSA-N |
| XLogP | 2.68 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|