C12H24ClN3O3Si — CID 102076473
(3R,5R)-3-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-chlorohexanoic acid (PubChem CID 102076473) has the molecular formula C12H24ClN3O3Si and a molecular weight of 321.88 g/mol. Its IUPAC name is (3R,5R)-3-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-chlorohexanoic acid.
| Compound Name | (3R,5R)-3-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-chlorohexanoic acid |
|---|---|
| PubChem CID | 102076473 |
| Molecular Formula | C12H24ClN3O3Si |
| Molecular Weight | 321.88 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (3R,5R)-3-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-chlorohexanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CCl)C[C@H](CC(=O)O)N=[N+]=[N-] |
| InChI | InChI=1S/C12H24ClN3O3Si/c1-12(2,3)20(4,5)19-10(8-13)6-9(15-16-14)7-11(17)18/h9-10H,6-8H2,1-5H3,(H,17,18)/t9-,10-/m1/s1 |
| InChIKey | MPNNOWMOVDINDQ-NXEZZACHSA-N |
| XLogP | 4.16 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.88 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|