C24H53ClO4Si3 — CID 10864320
(3S,4R,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]hexanoyl chloride (PubChem CID 10864320) has the molecular formula C24H53ClO4Si3 and a molecular weight of 525.40 g/mol. Its IUPAC name is (3S,4R,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]hexanoyl chloride.
| Compound Name | (3S,4R,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]hexanoyl chloride |
|---|---|
| PubChem CID | 10864320 |
| Molecular Formula | C24H53ClO4Si3 |
| Molecular Weight | 525.40 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | (3S,4R,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]hexanoyl chloride |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CC(=O)Cl)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H53ClO4Si3/c1-18(27-30(11,12)22(2,3)4)21(29-32(15,16)24(8,9)10)19(17-20(25)26)28-31(13,14)23(5,6)7/h18-19,21H,17H2,1-16H3/t18-,19+,21-/m1/s1 |
| InChIKey | WOIDKXFXDJYPHS-SVFBPWRDSA-N |
| XLogP | 8.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.40 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|