C11H25NO3Si — CID 10879449
methyl (2R,3S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxybutanoate (PubChem CID 10879449) has the molecular formula C11H25NO3Si and a molecular weight of 247.41 g/mol. Its IUPAC name is methyl (2R,3S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxybutanoate.
| Compound Name | methyl (2R,3S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxybutanoate |
|---|---|
| PubChem CID | 10879449 |
| Molecular Formula | C11H25NO3Si |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | methyl (2R,3S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxybutanoate |
| SMILES | COC(=O)[C@H](N)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H25NO3Si/c1-8(9(12)10(13)14-5)15-16(6,7)11(2,3)4/h8-9H,12H2,1-7H3/t8-,9+/m0/s1 |
| InChIKey | ZYWGWHMIMFCVAU-DTWKUNHWSA-N |
| XLogP | 1.90 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|