C18H36N2O3Si — CID 58760245
tert-butyl N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-cyano-4-methylpentan-2-yl]carbamate (PubChem CID 58760245) has the molecular formula C18H36N2O3Si and a molecular weight of 356.58 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-cyano-4-methylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-cyano-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 58760245 |
| Molecular Formula | C18H36N2O3Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | tert-butyl N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-cyano-4-methylpentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(C#N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36N2O3Si/c1-13(2)11-14(20-16(21)22-17(3,4)5)15(12-19)23-24(9,10)18(6,7)8/h13-15H,11H2,1-10H3,(H,20,21)/t14-,15?/m0/s1 |
| InChIKey | OVXKOHQQAIEFSV-MLCCFXAWSA-N |
| XLogP | 4.84 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|