C18H38N2O4Si — CID 19817513
tert-butyl N-[3-amino-2-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanoyl]carbamate (PubChem CID 19817513) has the molecular formula C18H38N2O4Si and a molecular weight of 374.60 g/mol. Its IUPAC name is tert-butyl N-[3-amino-2-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanoyl]carbamate.
| Compound Name | tert-butyl N-[3-amino-2-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanoyl]carbamate |
|---|---|
| PubChem CID | 19817513 |
| Molecular Formula | C18H38N2O4Si |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | tert-butyl N-[3-amino-2-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanoyl]carbamate |
| SMILES | CC(C)CC(N)C(O[Si](C)(C)C(C)(C)C)C(=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H38N2O4Si/c1-12(2)11-13(19)14(24-25(9,10)18(6,7)8)15(21)20-16(22)23-17(3,4)5/h12-14H,11,19H2,1-10H3,(H,20,21,22) |
| InChIKey | QXQRGZMZSJLOBV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|