C13H28N2O4Si — CID 139606123
tert-butyl N-[2-amino-2-[tert-butyl(dimethyl)silyl]oxyacetyl]carbamate (PubChem CID 139606123) has the molecular formula C13H28N2O4Si and a molecular weight of 304.46 g/mol. Its IUPAC name is tert-butyl N-[2-amino-2-[tert-butyl(dimethyl)silyl]oxyacetyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-2-[tert-butyl(dimethyl)silyl]oxyacetyl]carbamate |
|---|---|
| PubChem CID | 139606123 |
| Molecular Formula | C13H28N2O4Si |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl N-[2-amino-2-[tert-butyl(dimethyl)silyl]oxyacetyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=O)C(N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28N2O4Si/c1-12(2,3)18-11(17)15-10(16)9(14)19-20(7,8)13(4,5)6/h9H,14H2,1-8H3,(H,15,16,17) |
| InChIKey | WUUHCLBYELATID-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|