C11H20N2O5 — CID 89413297
methyl (2R)-2-(dimethylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropanoate (PubChem CID 89413297) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is methyl (2R)-2-(dimethylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropanoate.
| Compound Name | methyl (2R)-2-(dimethylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 89413297 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | methyl (2R)-2-(dimethylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropanoate |
| SMILES | COC(=O)[C@@H](C(=O)NC(=O)OC(C)(C)C)N(C)C |
| InChI | InChI=1S/C11H20N2O5/c1-11(2,3)18-10(16)12-8(14)7(13(4)5)9(15)17-6/h7H,1-6H3,(H,12,14,16)/t7-/m1/s1 |
| InChIKey | DHXHKLGNTWKYOU-SSDOTTSWSA-N |
| XLogP | 0.14 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|