C16H33NO3Si — CID 156749640
tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]carbamate (PubChem CID 156749640) has the molecular formula C16H33NO3Si and a molecular weight of 315.53 g/mol. Its IUPAC name is tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]carbamate.
| Compound Name | tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]carbamate |
|---|---|
| PubChem CID | 156749640 |
| Molecular Formula | C16H33NO3Si |
| Molecular Weight | 315.53 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]carbamate |
| SMILES | C=CC(CCNC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33NO3Si/c1-10-13(20-21(8,9)16(5,6)7)11-12-17-14(18)19-15(2,3)4/h10,13H,1,11-12H2,2-9H3,(H,17,18) |
| InChIKey | NQCRXJKOUWZELT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|