C21H39NO5Si — CID 25214795
(2S,4E)-8-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]deca-4,9-dienoic acid (PubChem CID 25214795) has the molecular formula C21H39NO5Si and a molecular weight of 413.63 g/mol. Its IUPAC name is (2S,4E)-8-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]deca-4,9-dienoic acid.
| Compound Name | (2S,4E)-8-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]deca-4,9-dienoic acid |
|---|---|
| PubChem CID | 25214795 |
| Molecular Formula | C21H39NO5Si |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | (2S,4E)-8-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]deca-4,9-dienoic acid |
| SMILES | C=CC(CC/C=C/C[C@H](NC(=O)OC(C)(C)C)C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H39NO5Si/c1-10-16(27-28(8,9)21(5,6)7)14-12-11-13-15-17(18(23)24)22-19(25)26-20(2,3)4/h10-11,13,16-17H,1,12,14-15H2,2-9H3,(H,22,25)(H,23,24)/b13-11+/t16?,17-/m0/s1 |
| InChIKey | PIASKPNIDGBQNV-CVLOLRLASA-N |
| XLogP | 5.27 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|