C18H23NO4 — CID 78088559
2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-phenylhepta-4,6-dienoic acid (PubChem CID 78088559) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-phenylhepta-4,6-dienoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-phenylhepta-4,6-dienoic acid |
|---|---|
| PubChem CID | 78088559 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-phenylhepta-4,6-dienoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CC=CC=Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H23NO4/c1-18(2,3)23-17(22)19-15(16(20)21)13-9-5-8-12-14-10-6-4-7-11-14/h4-12,15H,13H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | OHUSJUBYTMCHGI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|