C28H57NO4Si2 — CID 53248482
tert-butyl N-[(4R,6E,8S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]undeca-6,10-dienyl]carbamate (PubChem CID 53248482) has the molecular formula C28H57NO4Si2 and a molecular weight of 527.94 g/mol. Its IUPAC name is tert-butyl N-[(4R,6E,8S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]undeca-6,10-dienyl]carbamate.
| Compound Name | tert-butyl N-[(4R,6E,8S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]undeca-6,10-dienyl]carbamate |
|---|---|
| PubChem CID | 53248482 |
| Molecular Formula | C28H57NO4Si2 |
| Molecular Weight | 527.94 g/mol |
| Exact Mass | 527.38 |
| IUPAC Name | tert-butyl N-[(4R,6E,8S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]undeca-6,10-dienyl]carbamate |
| SMILES | C=CC[C@@H](/C=C/C[C@@H](CCCNC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H57NO4Si2/c1-15-18-23(32-34(11,12)27(5,6)7)19-16-20-24(33-35(13,14)28(8,9)10)21-17-22-29-25(30)31-26(2,3)4/h15-16,19,23-24H,1,17-18,20-22H2,2-14H3,(H,29,30)/b19-16+/t23-,24-/m0/s1 |
| InChIKey | CHWMGSLLDQMINI-UZFJSIRBSA-N |
| XLogP | 8.59 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.94 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|