C14H26N2O5 — CID 46867576
prop-2-enyl (2S)-2-(hydroxyamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 46867576) has the molecular formula C14H26N2O5 and a molecular weight of 302.37 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-(hydroxyamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | prop-2-enyl (2S)-2-(hydroxyamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 46867576 |
| Molecular Formula | C14H26N2O5 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | prop-2-enyl (2S)-2-(hydroxyamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | C=CCOC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NO |
| InChI | InChI=1S/C14H26N2O5/c1-5-10-20-12(17)11(16-19)8-6-7-9-15-13(18)21-14(2,3)4/h5,11,16,19H,1,6-10H2,2-4H3,(H,15,18)/t11-/m0/s1 |
| InChIKey | SLNIGUMUJAJOMJ-NSHDSACASA-N |
| XLogP | 1.76 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|