C14H27ClN2O4 — CID 91979202
prop-2-enyl 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride (PubChem CID 91979202) has the molecular formula C14H27ClN2O4 and a molecular weight of 322.83 g/mol. Its IUPAC name is prop-2-enyl 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride.
| Compound Name | prop-2-enyl 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride |
|---|---|
| PubChem CID | 91979202 |
| Molecular Formula | C14H27ClN2O4 |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | prop-2-enyl 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride |
| SMILES | C=CCOC(=O)C(N)CCCCNC(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C14H26N2O4.ClH/c1-5-10-19-12(17)11(15)8-6-7-9-16-13(18)20-14(2,3)4;/h5,11H,1,6-10,15H2,2-4H3,(H,16,18);1H |
| InChIKey | YNQZETUXDJXJQM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|