C17H31N3O5 — CID 87350508
methyl 2-[[(2R)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-prop-2-enylamino]acetate (PubChem CID 87350508) has the molecular formula C17H31N3O5 and a molecular weight of 357.45 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-prop-2-enylamino]acetate.
| Compound Name | methyl 2-[[(2R)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 87350508 |
| Molecular Formula | C17H31N3O5 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | methyl 2-[[(2R)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OC)C(=O)[C@H](N)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31N3O5/c1-6-11-20(12-14(21)24-5)15(22)13(18)9-7-8-10-19-16(23)25-17(2,3)4/h6,13H,1,7-12,18H2,2-5H3,(H,19,23)/t13-/m1/s1 |
| InChIKey | GDDLVROKLXRHNZ-CYBMUJFWSA-N |
| XLogP | 1.20 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|