C43H62N4O10 — CID 158278518
prop-2-enyl 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;prop-2-enyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 158278518) has the molecular formula C43H62N4O10 and a molecular weight of 794.99 g/mol. Its IUPAC name is prop-2-enyl 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;prop-2-enyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | prop-2-enyl 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;prop-2-enyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 158278518 |
| Molecular Formula | C43H62N4O10 |
| Molecular Weight | 794.99 g/mol |
| Exact Mass | 794.45 |
| IUPAC Name | prop-2-enyl 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;prop-2-enyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | C=CCOC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21.C=CCOC(=O)C(N)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H36N2O6.C14H26N2O4/c1-5-18-35-26(32)25(16-10-11-17-30-27(33)37-29(2,3)4)31-28(34)36-19-24-22-14-8-6-12-20(22)21-13-7-9-15-23(21)24;1-5-10-19-12(17)11(15)8-6-7-9-16-13(18)20-14(2,3)4/h5-9,12-15,24-25H,1,10-11,16-19H2,2-4H3,(H,30,33)(H,31,34);5,11H,1,6-10,15H2,2-4H3,(H,16,18) |
| InChIKey | GJXLGCGOFDXXLO-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 193.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.99 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|