C31H38N2O8 — CID 153400898
(4-oxo-4-prop-2-enoxybutyl) 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 153400898) has the molecular formula C31H38N2O8 and a molecular weight of 566.65 g/mol. Its IUPAC name is (4-oxo-4-prop-2-enoxybutyl) 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | (4-oxo-4-prop-2-enoxybutyl) 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 153400898 |
| Molecular Formula | C31H38N2O8 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | (4-oxo-4-prop-2-enoxybutyl) 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | C=CCOC(=O)CCCOC(=O)C(CCNC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H38N2O8/c1-5-18-38-27(34)15-10-19-39-28(35)26(16-17-32-29(36)41-31(2,3)4)33-30(37)40-20-25-23-13-8-6-11-21(23)22-12-7-9-14-24(22)25/h5-9,11-14,25-26H,1,10,15-20H2,2-4H3,(H,32,36)(H,33,37) |
| InChIKey | AAYOECRTTQPDNR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|