C31H44N2O7 — CID 178056656
6-hydroxyhexyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-formamidobutanoate;2-methoxy-2-methylpropane (PubChem CID 178056656) has the molecular formula C31H44N2O7 and a molecular weight of 556.70 g/mol. Its IUPAC name is 6-hydroxyhexyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-formamidobutanoate;2-methoxy-2-methylpropane.
| Compound Name | 6-hydroxyhexyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-formamidobutanoate;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 178056656 |
| Molecular Formula | C31H44N2O7 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | 6-hydroxyhexyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-formamidobutanoate;2-methoxy-2-methylpropane |
| SMILES | COC(C)(C)C.O=CNCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCCCCCCO |
| InChI | InChI=1S/C26H32N2O6.C5H12O/c29-15-7-1-2-8-16-33-25(31)24(13-14-27-18-30)28-26(32)34-17-23-21-11-5-3-9-19(21)20-10-4-6-12-22(20)23;1-5(2,3)6-4/h3-6,9-12,18,23-24,29H,1-2,7-8,13-17H2,(H,27,30)(H,28,32);1-4H3 |
| InChIKey | CDLQIQVHHAEMLF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|