C31H39NO6 — CID 166076206
1-O-octyl 5-O-prop-2-enyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate (PubChem CID 166076206) has the molecular formula C31H39NO6 and a molecular weight of 521.65 g/mol. Its IUPAC name is 1-O-octyl 5-O-prop-2-enyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate.
| Compound Name | 1-O-octyl 5-O-prop-2-enyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate |
|---|---|
| PubChem CID | 166076206 |
| Molecular Formula | C31H39NO6 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 1-O-octyl 5-O-prop-2-enyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate |
| SMILES | C=CCOC(=O)CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C31H39NO6/c1-3-5-6-7-8-13-21-37-30(34)28(18-19-29(33)36-20-4-2)32-31(35)38-22-27-25-16-11-9-14-23(25)24-15-10-12-17-26(24)27/h4,9-12,14-17,27-28H,2-3,5-8,13,18-22H2,1H3,(H,32,35)/t28-/m0/s1 |
| InChIKey | CMOOLCNJGOGEQY-NDEPHWFRSA-N |
| XLogP | 6.31 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|