C27H35NO4 — CID 172553228
octyl (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoate (PubChem CID 172553228) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is octyl (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoate.
| Compound Name | octyl (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoate |
|---|---|
| PubChem CID | 172553228 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | octyl (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoate |
| SMILES | CCCCCCCCOC(=O)[C@@H](C)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H35NO4/c1-3-4-5-6-7-12-17-31-26(29)20(2)18-28-27(30)32-19-25-23-15-10-8-13-21(23)22-14-9-11-16-24(22)25/h8-11,13-16,20,25H,3-7,12,17-19H2,1-2H3,(H,28,30)/t20-/m0/s1 |
| InChIKey | PVSPKBVFSQUEOU-FQEVSTJZSA-N |
| XLogP | 6.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|