C27H35NO5 — CID 138473516
(2R,3R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]-2-methylnonanoic acid (PubChem CID 138473516) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is (2R,3R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]-2-methylnonanoic acid.
| Compound Name | (2R,3R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]-2-methylnonanoic acid |
|---|---|
| PubChem CID | 138473516 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | (2R,3R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]-2-methylnonanoic acid |
| SMILES | CCCCCC[C@@H](OCCNC(=O)OCC1c2ccccc2-c2ccccc21)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C27H35NO5/c1-3-4-5-6-15-25(19(2)26(29)30)32-17-16-28-27(31)33-18-24-22-13-9-7-11-20(22)21-12-8-10-14-23(21)24/h7-14,19,24-25H,3-6,15-18H2,1-2H3,(H,28,31)(H,29,30)/t19-,25-/m1/s1 |
| InChIKey | MNDUOQRNXUGTGU-KBMIEXCESA-N |
| XLogP | 5.60 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|