C35H47N3O7 — CID 25034094
prop-2-enyl (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[[(2S,3S)-3-methyl-1-[(2-methylpropan-2-yl)oxy]-1-oxopentan-2-yl]carbamoylamino]hexanoate (PubChem CID 25034094) has the molecular formula C35H47N3O7 and a molecular weight of 621.78 g/mol. Its IUPAC name is prop-2-enyl (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[[(2S,3S)-3-methyl-1-[(2-methylpropan-2-yl)oxy]-1-oxopentan-2-yl]carbamoylamino]hexanoate.
| Compound Name | prop-2-enyl (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[[(2S,3S)-3-methyl-1-[(2-methylpropan-2-yl)oxy]-1-oxopentan-2-yl]carbamoylamino]hexanoate |
|---|---|
| PubChem CID | 25034094 |
| Molecular Formula | C35H47N3O7 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.34 |
| IUPAC Name | prop-2-enyl (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[[(2S,3S)-3-methyl-1-[(2-methylpropan-2-yl)oxy]-1-oxopentan-2-yl]carbamoylamino]hexanoate |
| SMILES | C=CCOC(=O)[C@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)NC(=O)N[C@H](C(=O)OC(C)(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C35H47N3O7/c1-7-21-43-31(39)29(37-33(41)38-30(23(3)8-2)32(40)45-35(4,5)6)19-13-14-20-36-34(42)44-22-28-26-17-11-9-15-24(26)25-16-10-12-18-27(25)28/h7,9-12,15-18,23,28-30H,1,8,13-14,19-22H2,2-6H3,(H,36,42)(H2,37,38,41)/t23-,29-,30-/m0/s1 |
| InChIKey | MOIVFOXFMKVNHV-HDXYBINASA-N |
| XLogP | 5.85 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|