C41H88N2O4Si2 — CID 171814668
tert-butyl N-[4-[bis[2-[tert-butyl(dimethyl)silyl]oxydecyl]amino]butyl]carbamate (PubChem CID 171814668) has the molecular formula C41H88N2O4Si2 and a molecular weight of 729.34 g/mol. Its IUPAC name is tert-butyl N-[4-[bis[2-[tert-butyl(dimethyl)silyl]oxydecyl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[bis[2-[tert-butyl(dimethyl)silyl]oxydecyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 171814668 |
| Molecular Formula | C41H88N2O4Si2 |
| Molecular Weight | 729.34 g/mol |
| Exact Mass | 728.63 |
| IUPAC Name | tert-butyl N-[4-[bis[2-[tert-butyl(dimethyl)silyl]oxydecyl]amino]butyl]carbamate |
| SMILES | CCCCCCCCC(CN(CCCCNC(=O)OC(C)(C)C)CC(CCCCCCCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C41H88N2O4Si2/c1-16-18-20-22-24-26-30-36(46-48(12,13)40(6,7)8)34-43(33-29-28-32-42-38(44)45-39(3,4)5)35-37(31-27-25-23-21-19-17-2)47-49(14,15)41(9,10)11/h36-37H,16-35H2,1-15H3,(H,42,44) |
| InChIKey | BTXCEYPJKZACBP-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.34 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|