C18H33NO4 — CID 138632585
10-[(2-methylpropan-2-yl)oxycarbonylamino]-6-prop-2-enyldecanoic acid (PubChem CID 138632585) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is 10-[(2-methylpropan-2-yl)oxycarbonylamino]-6-prop-2-enyldecanoic acid.
| Compound Name | 10-[(2-methylpropan-2-yl)oxycarbonylamino]-6-prop-2-enyldecanoic acid |
|---|---|
| PubChem CID | 138632585 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 10-[(2-methylpropan-2-yl)oxycarbonylamino]-6-prop-2-enyldecanoic acid |
| SMILES | C=CCC(CCCCNC(=O)OC(C)(C)C)CCCCC(=O)O |
| InChI | InChI=1S/C18H33NO4/c1-5-10-15(11-6-7-13-16(20)21)12-8-9-14-19-17(22)23-18(2,3)4/h5,15H,1,6-14H2,2-4H3,(H,19,22)(H,20,21) |
| InChIKey | GKYSSNHXCDJWJH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|