C18H35NO4Si — CID 11725893
[tert-butyl(dimethyl)silyl] 3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pent-4-enoate (PubChem CID 11725893) has the molecular formula C18H35NO4Si and a molecular weight of 357.57 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pent-4-enoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pent-4-enoate |
|---|---|
| PubChem CID | 11725893 |
| Molecular Formula | C18H35NO4Si |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pent-4-enoate |
| SMILES | C=CC(C)C(CNC(=O)OC(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H35NO4Si/c1-11-13(2)14(12-19-16(21)22-17(3,4)5)15(20)23-24(9,10)18(6,7)8/h11,13-14H,1,12H2,2-10H3,(H,19,21) |
| InChIKey | YTKOMAQTAKBOFP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|