C15H29NO4Si — CID 10245191
trimethylsilyl 3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pent-4-enoate (PubChem CID 10245191) has the molecular formula C15H29NO4Si and a molecular weight of 315.49 g/mol. Its IUPAC name is trimethylsilyl 3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pent-4-enoate.
| Compound Name | trimethylsilyl 3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pent-4-enoate |
|---|---|
| PubChem CID | 10245191 |
| Molecular Formula | C15H29NO4Si |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | trimethylsilyl 3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pent-4-enoate |
| SMILES | C=CC(C)C(CNC(=O)OC(C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C15H29NO4Si/c1-9-11(2)12(13(17)20-21(6,7)8)10-16-14(18)19-15(3,4)5/h9,11-12H,1,10H2,2-8H3,(H,16,18) |
| InChIKey | CKNPSIUBKQTCQM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|