C10H16BrF2NO2 — CID 156778586
tert-butyl N-[2-[bromo(difluoro)methyl]but-3-enyl]carbamate (PubChem CID 156778586) has the molecular formula C10H16BrF2NO2 and a molecular weight of 300.14 g/mol. Its IUPAC name is tert-butyl N-[2-[bromo(difluoro)methyl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[2-[bromo(difluoro)methyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 156778586 |
| Molecular Formula | C10H16BrF2NO2 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | tert-butyl N-[2-[bromo(difluoro)methyl]but-3-enyl]carbamate |
| SMILES | C=CC(CNC(=O)OC(C)(C)C)C(F)(F)Br |
| InChI | InChI=1S/C10H16BrF2NO2/c1-5-7(10(11,12)13)6-14-8(15)16-9(2,3)4/h5,7H,1,6H2,2-4H3,(H,14,15) |
| InChIKey | FSQSJNNIFNXWIV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|