C14H31N3O4Si — CID 153328579
tert-butyl N-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydrazinyl-3-oxopropyl]carbamate (PubChem CID 153328579) has the molecular formula C14H31N3O4Si and a molecular weight of 333.51 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydrazinyl-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydrazinyl-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 153328579 |
| Molecular Formula | C14H31N3O4Si |
| Molecular Weight | 333.51 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | tert-butyl N-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydrazinyl-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H](O[Si](C)(C)C(C)(C)C)C(=O)NN |
| InChI | InChI=1S/C14H31N3O4Si/c1-13(2,3)20-12(19)16-9-10(11(18)17-15)21-22(7,8)14(4,5)6/h10H,9,15H2,1-8H3,(H,16,19)(H,17,18)/t10-/m0/s1 |
| InChIKey | MSXKSRQYLPZIMB-JTQLQIEISA-N |
| XLogP | 1.89 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.51 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|