C17H34BrN3O3Si — CID 155642130
tert-butyl N-[(2S)-3-[[(E)-3-amino-2-bromoprop-2-enylidene]amino]-2-[tert-butyl(dimethyl)silyl]oxypropyl]carbamate (PubChem CID 155642130) has the molecular formula C17H34BrN3O3Si and a molecular weight of 436.47 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-[[(E)-3-amino-2-bromoprop-2-enylidene]amino]-2-[tert-butyl(dimethyl)silyl]oxypropyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-[[(E)-3-amino-2-bromoprop-2-enylidene]amino]-2-[tert-butyl(dimethyl)silyl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 155642130 |
| Molecular Formula | C17H34BrN3O3Si |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | tert-butyl N-[(2S)-3-[[(E)-3-amino-2-bromoprop-2-enylidene]amino]-2-[tert-butyl(dimethyl)silyl]oxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](C/N=C/C(Br)=C\N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34BrN3O3Si/c1-16(2,3)23-15(22)21-12-14(11-20-10-13(18)9-19)24-25(7,8)17(4,5)6/h9-10,14H,11-12,19H2,1-8H3,(H,21,22)/b13-9+,20-10+/t14-/m1/s1 |
| InChIKey | CPZBHEYZYWOVOI-CEMJFQKRSA-N |
| XLogP | 4.17 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|