C15H33NO6SSi — CID 140880816
[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate (PubChem CID 140880816) has the molecular formula C15H33NO6SSi and a molecular weight of 383.58 g/mol. Its IUPAC name is [(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate.
| Compound Name | [(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
|---|---|
| PubChem CID | 140880816 |
| Molecular Formula | C15H33NO6SSi |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](COS(C)(=O)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H33NO6SSi/c1-14(2,3)21-13(17)16-10-12(11-20-23(7,18)19)22-24(8,9)15(4,5)6/h12H,10-11H2,1-9H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | GUNFKEWQOGAEKE-LBPRGKRZSA-N |
| XLogP | 2.88 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|