C18H36F3N4O6SSi+ — CID 161167398
[(2S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonyloxy-2-(trifluoromethyl)pentyl]imino-iminoazanium (PubChem CID 161167398) has the molecular formula C18H36F3N4O6SSi+ and a molecular weight of 521.66 g/mol. Its IUPAC name is [(2S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonyloxy-2-(trifluoromethyl)pentyl]imino-iminoazanium.
| Compound Name | [(2S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonyloxy-2-(trifluoromethyl)pentyl]imino-iminoazanium |
|---|---|
| PubChem CID | 161167398 |
| Molecular Formula | C18H36F3N4O6SSi+ |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | [(2S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonyloxy-2-(trifluoromethyl)pentyl]imino-iminoazanium |
| SMILES | CC(C)(C)OC(=O)N[C@H](COS(C)(=O)=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CN=[N+]=N)C(F)(F)F |
| InChI | InChI=1S/C18H35F3N4O6SSi/c1-16(2,3)30-15(26)24-13(11-29-32(7,27)28)14(31-33(8,9)17(4,5)6)12(10-23-25-22)18(19,20)21/h12-14,22H,10-11H2,1-9H3/p+1/t12-,13+,14+/m0/s1 |
| InChIKey | UQSOAVWHLBQAKZ-BFHYXJOUSA-O |
| XLogP | 3.98 |
| TPSA | 141.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|