C13H27NO8S2 — CID 142531974
[(4R)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonyloxypentyl] methanesulfonate (PubChem CID 142531974) has the molecular formula C13H27NO8S2 and a molecular weight of 389.49 g/mol. Its IUPAC name is [(4R)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonyloxypentyl] methanesulfonate.
| Compound Name | [(4R)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonyloxypentyl] methanesulfonate |
|---|---|
| PubChem CID | 142531974 |
| Molecular Formula | C13H27NO8S2 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | [(4R)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonyloxypentyl] methanesulfonate |
| SMILES | CC(COS(C)(=O)=O)C[C@H](COS(C)(=O)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H27NO8S2/c1-10(8-20-23(5,16)17)7-11(9-21-24(6,18)19)14-12(15)22-13(2,3)4/h10-11H,7-9H2,1-6H3,(H,14,15)/t10?,11-/m1/s1 |
| InChIKey | NQPSKPGQESKQCB-RRKGBCIJSA-N |
| XLogP | 0.86 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|