C11H23NO5S2 — CID 85120556
[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutyl] methanesulfonate (PubChem CID 85120556) has the molecular formula C11H23NO5S2 and a molecular weight of 313.44 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutyl] methanesulfonate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutyl] methanesulfonate |
|---|---|
| PubChem CID | 85120556 |
| Molecular Formula | C11H23NO5S2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutyl] methanesulfonate |
| SMILES | CSCCC(COS(C)(=O)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H23NO5S2/c1-11(2,3)17-10(13)12-9(6-7-18-4)8-16-19(5,14)15/h9H,6-8H2,1-5H3,(H,12,13) |
| InChIKey | YSCDFIKIVGRQDW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|