C15H27F2NO5S — CID 87303273
[(2R)-3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate (PubChem CID 87303273) has the molecular formula C15H27F2NO5S and a molecular weight of 371.45 g/mol. Its IUPAC name is [(2R)-3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate.
| Compound Name | [(2R)-3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
|---|---|
| PubChem CID | 87303273 |
| Molecular Formula | C15H27F2NO5S |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | [(2R)-3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COS(C)(=O)=O)CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C15H27F2NO5S/c1-14(2,3)23-13(19)18-12(10-22-24(4,20)21)9-11-5-7-15(16,17)8-6-11/h11-12H,5-10H2,1-4H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | XKKJYPHJWFYFCE-GFCCVEGCSA-N |
| XLogP | 3.07 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|