C16H27F2NO3 — CID 143487086
tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-methoxybut-3-en-2-yl]carbamate (PubChem CID 143487086) has the molecular formula C16H27F2NO3 and a molecular weight of 319.39 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-methoxybut-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-methoxybut-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 143487086 |
| Molecular Formula | C16H27F2NO3 |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-methoxybut-3-en-2-yl]carbamate |
| SMILES | C=C(OC)[C@H](CC1CCC(F)(F)CC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27F2NO3/c1-11(21-5)13(19-14(20)22-15(2,3)4)10-12-6-8-16(17,18)9-7-12/h12-13H,1,6-10H2,2-5H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | DLPHRMOXMWMNRE-ZDUSSCGKSA-N |
| XLogP | 4.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|