C12H19F2NO3 — CID 138628336
methyl (2S)-2-acetamido-3-(4,4-difluorocyclohexyl)propanoate (PubChem CID 138628336) has the molecular formula C12H19F2NO3 and a molecular weight of 263.28 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-3-(4,4-difluorocyclohexyl)propanoate.
| Compound Name | methyl (2S)-2-acetamido-3-(4,4-difluorocyclohexyl)propanoate |
|---|---|
| PubChem CID | 138628336 |
| Molecular Formula | C12H19F2NO3 |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | methyl (2S)-2-acetamido-3-(4,4-difluorocyclohexyl)propanoate |
| SMILES | COC(=O)[C@H](CC1CCC(F)(F)CC1)NC(C)=O |
| InChI | InChI=1S/C12H19F2NO3/c1-8(16)15-10(11(17)18-2)7-9-3-5-12(13,14)6-4-9/h9-10H,3-7H2,1-2H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | UJFBHEYJPUTTBC-JTQLQIEISA-N |
| XLogP | 1.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |