C10H16F2O2 — CID 76804780
methyl 2-(4,4-difluorocyclohexyl)propanoate (PubChem CID 76804780) has the molecular formula C10H16F2O2 and a molecular weight of 206.23 g/mol. Its IUPAC name is methyl 2-(4,4-difluorocyclohexyl)propanoate.
| Compound Name | methyl 2-(4,4-difluorocyclohexyl)propanoate |
|---|---|
| PubChem CID | 76804780 |
| Molecular Formula | C10H16F2O2 |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | methyl 2-(4,4-difluorocyclohexyl)propanoate |
| SMILES | COC(=O)C(C)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H16F2O2/c1-7(9(13)14-2)8-3-5-10(11,12)6-4-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | CYJYAZCPHWUTAW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |