C13H20F2O3 — CID 152865131
methyl (2R)-2-[(4,4-difluorocyclohexyl)methyl]-4-oxopentanoate (PubChem CID 152865131) has the molecular formula C13H20F2O3 and a molecular weight of 262.30 g/mol. Its IUPAC name is methyl (2R)-2-[(4,4-difluorocyclohexyl)methyl]-4-oxopentanoate.
| Compound Name | methyl (2R)-2-[(4,4-difluorocyclohexyl)methyl]-4-oxopentanoate |
|---|---|
| PubChem CID | 152865131 |
| Molecular Formula | C13H20F2O3 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | methyl (2R)-2-[(4,4-difluorocyclohexyl)methyl]-4-oxopentanoate |
| SMILES | COC(=O)[C@@H](CC(C)=O)CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H20F2O3/c1-9(16)7-11(12(17)18-2)8-10-3-5-13(14,15)6-4-10/h10-11H,3-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | TYHURGVNOHFLFM-NSHDSACASA-N |
| XLogP | 2.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |