About methyl (2S)-2-[[(1S)-3,3-difluorocyclopentyl]methyl]butanoate
methyl (2S)-2-[[(1S)-3,3-difluorocyclopentyl]methyl]butanoate (PubChem CID 58484957) has the molecular formula C11H18F2O2
and a molecular weight of 220.26 g/mol. Its IUPAC name is methyl (2S)-2-[[(1S)-3,3-difluorocyclopentyl]methyl]butanoate.
Analyze methyl (2S)-2-[[(1S)-3,3-difluorocyclopentyl]methyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[[(1S)-3,3-difluorocyclopentyl]methyl]butanoate?
The IUPAC name of methyl (2S)-2-[[(1S)-3,3-difluorocyclopentyl]methyl]butanoate (CID 58484957) is methyl (2S)-2-[[(1S)-3,3-difluorocyclopentyl]methyl]butanoate.
What is the SMILES notation for methyl (2S)-2-[[(1S)-3,3-difluorocyclopentyl]methyl]butanoate?
The canonical SMILES for methyl (2S)-2-[[(1S)-3,3-difluorocyclopentyl]methyl]butanoate is CC[C@@H](C[C@@H]1CCC(F)(F)C1)C(=O)OC.
What is the InChIKey of methyl (2S)-2-[[(1S)-3,3-difluorocyclopentyl]methyl]butanoate?
The InChIKey is ZZNYKXSRDYFQRB-IUCAKERBSA-N. The full InChI is InChI=1S/C11H18F2O2/c1-3-9(10(14)15-2)6-8-4-5-11(12,13)7-8/h8-9H,3-7H2,1-2H3/t8-,9-/m0/s1.
What are the key properties of methyl (2S)-2-[[(1S)-3,3-difluorocyclopentyl]methyl]butanoate?
methyl (2S)-2-[[(1S)-3,3-difluorocyclopentyl]methyl]butanoate has a molecular weight of 220.26 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[[(1S)-3,3-difluorocyclopentyl]methyl]butanoate is sourced from PubChem (CID 58484957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).