C6H11F2NO — CID 126974531
O-[(3,3-difluorocyclopentyl)methyl]hydroxylamine (PubChem CID 126974531) has the molecular formula C6H11F2NO and a molecular weight of 151.16 g/mol. Its IUPAC name is O-[(3,3-difluorocyclopentyl)methyl]hydroxylamine.
| Compound Name | O-[(3,3-difluorocyclopentyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 126974531 |
| Molecular Formula | C6H11F2NO |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | O-[(3,3-difluorocyclopentyl)methyl]hydroxylamine |
| SMILES | NOCC1CCC(F)(F)C1 |
| InChI | InChI=1S/C6H11F2NO/c7-6(8)2-1-5(3-6)4-10-9/h5H,1-4,9H2 |
| InChIKey | ZSEAYSRGQAMEJD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|